Reaction ID:0000000001
Reactant:150.00 eq. O Br - OBDepict
InChiInChI=1S/C7H7BrO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3
Name4-bromoanisole
Reactant:100.00 eq. O O H - OBDepict
InChiInChI=1S/C7H8O2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3
Namep-methoxyphenol
Ligand:20.00 eq. N O HO - OBDepict
Namen,n-dimethylglycine hydrochloride
Catalyst:10.00 eq. Copper(I) iodide
Base:200.00 eq. Tripotassium phosphate
Temperature80 °C
Reaction time135 min.
Solvent:999.99 eq. - OBDepict
Nametoluene
Product:66.00 eq. O O O - OBDepict
Name4,4’-Dimethoxydiphenyl ether
InChiInChI=1S/C14H14O3/c1-15-11-3-7-13(8-4-11)17-14-9-5-12(16-2)6-10-14/h3-10H,1-2H3
DOI10.3762/bjoc.8.122
URLlink
Reaction type:Ullmann condensation